C22H20F6N2O5 — CID 122513860
N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N-propan-2-yl-3-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 122513860) has the molecular formula C22H20F6N2O5 and a molecular weight of 506.40 g/mol. Its IUPAC name is N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N-propan-2-yl-3-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N-propan-2-yl-3-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 122513860 |
| Molecular Formula | C22H20F6N2O5 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N-propan-2-yl-3-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)N(C(=O)c1cccc(C(F)(F)F)c1)c1ccccc1/C=C/C(=O)NO.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H19F3N2O3.C2HF3O2/c1-13(2)25(17-9-4-3-6-14(17)10-11-18(26)24-28)19(27)15-7-5-8-16(12-15)20(21,22)23;3-2(4,5)1(6)7/h3-13,28H,1-2H3,(H,24,26);(H,6,7)/b11-10+; |
| InChIKey | ZJRXSWRGFVMQKZ-ASTDGNLGSA-N |
| XLogP | 4.91 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|