C25H22F3NO4S — CID 12017709
4-[(E)-2-[2-[benzenesulfonyl(propan-2-yl)amino]-5-(trifluoromethyl)phenyl]ethenyl]benzoic acid (PubChem CID 12017709) has the molecular formula C25H22F3NO4S and a molecular weight of 489.52 g/mol. Its IUPAC name is 4-[(E)-2-[2-[benzenesulfonyl(propan-2-yl)amino]-5-(trifluoromethyl)phenyl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-[2-[benzenesulfonyl(propan-2-yl)amino]-5-(trifluoromethyl)phenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 12017709 |
| Molecular Formula | C25H22F3NO4S |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 4-[(E)-2-[2-[benzenesulfonyl(propan-2-yl)amino]-5-(trifluoromethyl)phenyl]ethenyl]benzoic acid |
| SMILES | CC(C)N(c1ccc(C(F)(F)F)cc1/C=C/c1ccc(C(=O)O)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22F3NO4S/c1-17(2)29(34(32,33)22-6-4-3-5-7-22)23-15-14-21(25(26,27)28)16-20(23)13-10-18-8-11-19(12-9-18)24(30)31/h3-17H,1-2H3,(H,30,31)/b13-10+ |
| InChIKey | HKUZJHCMRDMIJO-JLHYYAGUSA-N |
| XLogP | 6.18 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|