C22H26F3NO5S — CID 139818471
6-[2-[benzenesulfonyl(propan-2-yl)amino]-5-(trifluoromethyl)phenoxy]hexanoic acid (PubChem CID 139818471) has the molecular formula C22H26F3NO5S and a molecular weight of 473.51 g/mol. Its IUPAC name is 6-[2-[benzenesulfonyl(propan-2-yl)amino]-5-(trifluoromethyl)phenoxy]hexanoic acid.
| Compound Name | 6-[2-[benzenesulfonyl(propan-2-yl)amino]-5-(trifluoromethyl)phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 139818471 |
| Molecular Formula | C22H26F3NO5S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 6-[2-[benzenesulfonyl(propan-2-yl)amino]-5-(trifluoromethyl)phenoxy]hexanoic acid |
| SMILES | CC(C)N(c1ccc(C(F)(F)F)cc1OCCCCCC(=O)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26F3NO5S/c1-16(2)26(32(29,30)18-9-5-3-6-10-18)19-13-12-17(22(23,24)25)15-20(19)31-14-8-4-7-11-21(27)28/h3,5-6,9-10,12-13,15-16H,4,7-8,11,14H2,1-2H3,(H,27,28) |
| InChIKey | BZKOFJOAFCYRLB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|