C24H24F3NO4S — CID 141001977
4-methoxy-N-[2-phenylmethoxy-4-(trifluoromethyl)phenyl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 141001977) has the molecular formula C24H24F3NO4S and a molecular weight of 479.52 g/mol. Its IUPAC name is 4-methoxy-N-[2-phenylmethoxy-4-(trifluoromethyl)phenyl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-methoxy-N-[2-phenylmethoxy-4-(trifluoromethyl)phenyl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 141001977 |
| Molecular Formula | C24H24F3NO4S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 4-methoxy-N-[2-phenylmethoxy-4-(trifluoromethyl)phenyl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(c2ccc(C(F)(F)F)cc2OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C24H24F3NO4S/c1-17(2)28(33(29,30)21-12-10-20(31-3)11-13-21)22-14-9-19(24(25,26)27)15-23(22)32-16-18-7-5-4-6-8-18/h4-15,17H,16H2,1-3H3 |
| InChIKey | IHKNRGCXYBQWGY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |