C24H22F3NO6S — CID 87204690
methoxymethyl 4-[[2-[benzenesulfonyl(methyl)amino]-5-(trifluoromethyl)phenoxy]methyl]benzoate (PubChem CID 87204690) has the molecular formula C24H22F3NO6S and a molecular weight of 509.50 g/mol. Its IUPAC name is methoxymethyl 4-[[2-[benzenesulfonyl(methyl)amino]-5-(trifluoromethyl)phenoxy]methyl]benzoate.
| Compound Name | methoxymethyl 4-[[2-[benzenesulfonyl(methyl)amino]-5-(trifluoromethyl)phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 87204690 |
| Molecular Formula | C24H22F3NO6S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | methoxymethyl 4-[[2-[benzenesulfonyl(methyl)amino]-5-(trifluoromethyl)phenoxy]methyl]benzoate |
| SMILES | COCOC(=O)c1ccc(COc2cc(C(F)(F)F)ccc2N(C)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22F3NO6S/c1-28(35(30,31)20-6-4-3-5-7-20)21-13-12-19(24(25,26)27)14-22(21)33-15-17-8-10-18(11-9-17)23(29)34-16-32-2/h3-14H,15-16H2,1-2H3 |
| InChIKey | SEAFJZPSRMRJEY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|