C25H25F3N2O6S — CID 22672174
4-[[2-[benzenesulfonyl(methyl)amino]-5-(trifluoromethyl)phenoxy]methyl]benzoic acid;N,N-dimethylformamide (PubChem CID 22672174) has the molecular formula C25H25F3N2O6S and a molecular weight of 538.54 g/mol. Its IUPAC name is 4-[[2-[benzenesulfonyl(methyl)amino]-5-(trifluoromethyl)phenoxy]methyl]benzoic acid;N,N-dimethylformamide.
| Compound Name | 4-[[2-[benzenesulfonyl(methyl)amino]-5-(trifluoromethyl)phenoxy]methyl]benzoic acid;N,N-dimethylformamide |
|---|---|
| PubChem CID | 22672174 |
| Molecular Formula | C25H25F3N2O6S |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 4-[[2-[benzenesulfonyl(methyl)amino]-5-(trifluoromethyl)phenoxy]methyl]benzoic acid;N,N-dimethylformamide |
| SMILES | CN(C)C=O.CN(c1ccc(C(F)(F)F)cc1OCc1ccc(C(=O)O)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18F3NO5S.C3H7NO/c1-26(32(29,30)18-5-3-2-4-6-18)19-12-11-17(22(23,24)25)13-20(19)31-14-15-7-9-16(10-8-15)21(27)28;1-4(2)3-5/h2-13H,14H2,1H3,(H,27,28);3H,1-2H3 |
| InChIKey | JBDIWBGGQMAAFU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|