C21H18ClNO5S — CID 15922874
4-[[2-[benzenesulfonyl(methyl)amino]-5-chlorophenoxy]methyl]benzoic acid (PubChem CID 15922874) has the molecular formula C21H18ClNO5S and a molecular weight of 431.90 g/mol. Its IUPAC name is 4-[[2-[benzenesulfonyl(methyl)amino]-5-chlorophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[benzenesulfonyl(methyl)amino]-5-chlorophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 15922874 |
| Molecular Formula | C21H18ClNO5S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 4-[[2-[benzenesulfonyl(methyl)amino]-5-chlorophenoxy]methyl]benzoic acid |
| SMILES | CN(c1ccc(Cl)cc1OCc1ccc(C(=O)O)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H18ClNO5S/c1-23(29(26,27)18-5-3-2-4-6-18)19-12-11-17(22)13-20(19)28-14-15-7-9-16(10-8-15)21(24)25/h2-13H,14H2,1H3,(H,24,25) |
| InChIKey | FDFKREHZDFUDRU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |