C24H24ClNO7S — CID 15922880
4-[[2-[benzenesulfonyl(2-methoxyethoxymethyl)amino]-4-chlorophenoxy]methyl]benzoic acid (PubChem CID 15922880) has the molecular formula C24H24ClNO7S and a molecular weight of 505.98 g/mol. Its IUPAC name is 4-[[2-[benzenesulfonyl(2-methoxyethoxymethyl)amino]-4-chlorophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[benzenesulfonyl(2-methoxyethoxymethyl)amino]-4-chlorophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 15922880 |
| Molecular Formula | C24H24ClNO7S |
| Molecular Weight | 505.98 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 4-[[2-[benzenesulfonyl(2-methoxyethoxymethyl)amino]-4-chlorophenoxy]methyl]benzoic acid |
| SMILES | COCCOCN(c1cc(Cl)ccc1OCc1ccc(C(=O)O)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24ClNO7S/c1-31-13-14-32-17-26(34(29,30)21-5-3-2-4-6-21)22-15-20(25)11-12-23(22)33-16-18-7-9-19(10-8-18)24(27)28/h2-12,15H,13-14,16-17H2,1H3,(H,27,28) |
| InChIKey | UDLSSTIANAPVEZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.98 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|