C22H20ClNO6S — CID 15922875
4-[[2-[benzenesulfonyl(2-hydroxyethyl)amino]-5-chlorophenoxy]methyl]benzoic acid (PubChem CID 15922875) has the molecular formula C22H20ClNO6S and a molecular weight of 461.92 g/mol. Its IUPAC name is 4-[[2-[benzenesulfonyl(2-hydroxyethyl)amino]-5-chlorophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[benzenesulfonyl(2-hydroxyethyl)amino]-5-chlorophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 15922875 |
| Molecular Formula | C22H20ClNO6S |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 4-[[2-[benzenesulfonyl(2-hydroxyethyl)amino]-5-chlorophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2cc(Cl)ccc2N(CCO)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20ClNO6S/c23-18-10-11-20(24(12-13-25)31(28,29)19-4-2-1-3-5-19)21(14-18)30-15-16-6-8-17(9-7-16)22(26)27/h1-11,14,25H,12-13,15H2,(H,26,27) |
| InChIKey | WAXUGAIWRJSRRT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |