C25H26ClNO4S — CID 11641377
4-[2-[2-[butyl-(4-chlorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 11641377) has the molecular formula C25H26ClNO4S and a molecular weight of 472.01 g/mol. Its IUPAC name is 4-[2-[2-[butyl-(4-chlorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-[butyl-(4-chlorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 11641377 |
| Molecular Formula | C25H26ClNO4S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 4-[2-[2-[butyl-(4-chlorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | CCCCN(c1ccccc1CCc1ccc(C(=O)O)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H26ClNO4S/c1-2-3-18-27(32(30,31)23-16-14-22(26)15-17-23)24-7-5-4-6-20(24)11-8-19-9-12-21(13-10-19)25(28)29/h4-7,9-10,12-17H,2-3,8,11,18H2,1H3,(H,28,29) |
| InChIKey | SQFCIAQFEMZQRL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |