C28H32FNO4S — CID 68689398
4-[2-[2-[(4-fluorophenyl)sulfonyl-heptylamino]phenyl]ethyl]benzoic acid (PubChem CID 68689398) has the molecular formula C28H32FNO4S and a molecular weight of 497.63 g/mol. Its IUPAC name is 4-[2-[2-[(4-fluorophenyl)sulfonyl-heptylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-[(4-fluorophenyl)sulfonyl-heptylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68689398 |
| Molecular Formula | C28H32FNO4S |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 4-[2-[2-[(4-fluorophenyl)sulfonyl-heptylamino]phenyl]ethyl]benzoic acid |
| SMILES | CCCCCCCN(c1ccccc1CCc1ccc(C(=O)O)cc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H32FNO4S/c1-2-3-4-5-8-21-30(35(33,34)26-19-17-25(29)18-20-26)27-10-7-6-9-23(27)14-11-22-12-15-24(16-13-22)28(31)32/h6-7,9-10,12-13,15-20H,2-5,8,11,14,21H2,1H3,(H,31,32) |
| InChIKey | LZCIVTPQXPWEEF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|