C25H26FNO4S — CID 68689101
4-[2-[2-[butyl-(2-fluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 68689101) has the molecular formula C25H26FNO4S and a molecular weight of 455.55 g/mol. Its IUPAC name is 4-[2-[2-[butyl-(2-fluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-[butyl-(2-fluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68689101 |
| Molecular Formula | C25H26FNO4S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 4-[2-[2-[butyl-(2-fluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | CCCCN(c1ccccc1CCc1ccc(C(=O)O)cc1)S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C25H26FNO4S/c1-2-3-18-27(32(30,31)24-11-7-5-9-22(24)26)23-10-6-4-8-20(23)15-12-19-13-16-21(17-14-19)25(28)29/h4-11,13-14,16-17H,2-3,12,15,18H2,1H3,(H,28,29) |
| InChIKey | LPNMGDNSQRLDNK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |