C29H32N2O4S — CID 68692458
4-[2-[2-[(2-cyanophenyl)sulfonyl-heptylamino]phenyl]ethyl]benzoic acid (PubChem CID 68692458) has the molecular formula C29H32N2O4S and a molecular weight of 504.65 g/mol. Its IUPAC name is 4-[2-[2-[(2-cyanophenyl)sulfonyl-heptylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-[(2-cyanophenyl)sulfonyl-heptylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68692458 |
| Molecular Formula | C29H32N2O4S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 4-[2-[2-[(2-cyanophenyl)sulfonyl-heptylamino]phenyl]ethyl]benzoic acid |
| SMILES | CCCCCCCN(c1ccccc1CCc1ccc(C(=O)O)cc1)S(=O)(=O)c1ccccc1C#N |
| InChI | InChI=1S/C29H32N2O4S/c1-2-3-4-5-10-21-31(36(34,35)28-14-9-7-12-26(28)22-30)27-13-8-6-11-24(27)18-15-23-16-19-25(20-17-23)29(32)33/h6-9,11-14,16-17,19-20H,2-5,10,15,18,21H2,1H3,(H,32,33) |
| InChIKey | OKBJCRGFZBEVLL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|