C25H25F2NO4S — CID 68688710
4-[2-[2-[butyl-(2,6-difluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 68688710) has the molecular formula C25H25F2NO4S and a molecular weight of 473.54 g/mol. Its IUPAC name is 4-[2-[2-[butyl-(2,6-difluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-[butyl-(2,6-difluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68688710 |
| Molecular Formula | C25H25F2NO4S |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 4-[2-[2-[butyl-(2,6-difluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | CCCCN(c1ccccc1CCc1ccc(C(=O)O)cc1)S(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C25H25F2NO4S/c1-2-3-17-28(33(31,32)24-21(26)8-6-9-22(24)27)23-10-5-4-7-19(23)14-11-18-12-15-20(16-13-18)25(29)30/h4-10,12-13,15-16H,2-3,11,14,17H2,1H3,(H,29,30) |
| InChIKey | MQICUTWVPPAPLA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |