C21H18FNO4S — CID 68689846
4-[2-[4-[(2-fluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 68689846) has the molecular formula C21H18FNO4S and a molecular weight of 399.44 g/mol. Its IUPAC name is 4-[2-[4-[(2-fluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[4-[(2-fluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68689846 |
| Molecular Formula | C21H18FNO4S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 4-[2-[4-[(2-fluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCc2ccc(NS(=O)(=O)c3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C21H18FNO4S/c22-19-3-1-2-4-20(19)28(26,27)23-18-13-9-16(10-14-18)6-5-15-7-11-17(12-8-15)21(24)25/h1-4,7-14,23H,5-6H2,(H,24,25) |
| InChIKey | MLRLQCNIGCNJHH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |