C21H17Cl2NO4S — CID 68688791
4-[2-[3-[(2,5-dichlorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 68688791) has the molecular formula C21H17Cl2NO4S and a molecular weight of 450.34 g/mol. Its IUPAC name is 4-[2-[3-[(2,5-dichlorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[3-[(2,5-dichlorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68688791 |
| Molecular Formula | C21H17Cl2NO4S |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 4-[2-[3-[(2,5-dichlorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCc2cccc(NS(=O)(=O)c3cc(Cl)ccc3Cl)c2)cc1 |
| InChI | InChI=1S/C21H17Cl2NO4S/c22-17-10-11-19(23)20(13-17)29(27,28)24-18-3-1-2-15(12-18)5-4-14-6-8-16(9-7-14)21(25)26/h1-3,6-13,24H,4-5H2,(H,25,26) |
| InChIKey | LNMUNRVHJCUSTE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |