C19H13Cl2NO3S — CID 90665331
N-(3-benzoylphenyl)-2,4-dichlorobenzenesulfonamide (PubChem CID 90665331) has the molecular formula C19H13Cl2NO3S and a molecular weight of 406.29 g/mol. Its IUPAC name is N-(3-benzoylphenyl)-2,4-dichlorobenzenesulfonamide.
| Compound Name | N-(3-benzoylphenyl)-2,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 90665331 |
| Molecular Formula | C19H13Cl2NO3S |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | N-(3-benzoylphenyl)-2,4-dichlorobenzenesulfonamide |
| SMILES | O=C(c1ccccc1)c1cccc(NS(=O)(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C19H13Cl2NO3S/c20-15-9-10-18(17(21)12-15)26(24,25)22-16-8-4-7-14(11-16)19(23)13-5-2-1-3-6-13/h1-12,22H |
| InChIKey | KLHUDMURQSAHAW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |