C16H11Cl2NO6S — CID 510781
4-[3-[(2,4-dichlorophenyl)sulfonylamino]phenyl]-2,4-dioxobutanoic acid (PubChem CID 510781) has the molecular formula C16H11Cl2NO6S and a molecular weight of 416.24 g/mol. Its IUPAC name is 4-[3-[(2,4-dichlorophenyl)sulfonylamino]phenyl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[3-[(2,4-dichlorophenyl)sulfonylamino]phenyl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 510781 |
| Molecular Formula | C16H11Cl2NO6S |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 4-[3-[(2,4-dichlorophenyl)sulfonylamino]phenyl]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cccc(NS(=O)(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H11Cl2NO6S/c17-10-4-5-15(12(18)7-10)26(24,25)19-11-3-1-2-9(6-11)13(20)8-14(21)16(22)23/h1-7,19H,8H2,(H,22,23) |
| InChIKey | NHLODJOXAIJKKD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|