C16H10Cl3NO6S — CID 510778
2,4-dioxo-4-[3-[(2,4,6-trichlorophenyl)sulfonylamino]phenyl]butanoic acid (PubChem CID 510778) has the molecular formula C16H10Cl3NO6S and a molecular weight of 450.68 g/mol. Its IUPAC name is 2,4-dioxo-4-[3-[(2,4,6-trichlorophenyl)sulfonylamino]phenyl]butanoic acid.
| Compound Name | 2,4-dioxo-4-[3-[(2,4,6-trichlorophenyl)sulfonylamino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 510778 |
| Molecular Formula | C16H10Cl3NO6S |
| Molecular Weight | 450.68 g/mol |
| Exact Mass | 448.93 |
| IUPAC Name | 2,4-dioxo-4-[3-[(2,4,6-trichlorophenyl)sulfonylamino]phenyl]butanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cccc(NS(=O)(=O)c2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H10Cl3NO6S/c17-9-5-11(18)15(12(19)6-9)27(25,26)20-10-3-1-2-8(4-10)13(21)7-14(22)16(23)24/h1-6,20H,7H2,(H,23,24) |
| InChIKey | QCGWMEJOBPNXMP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|