C16H17ClN2O3S — CID 24629332
3-[(2-chloro-4-methylphenyl)sulfonylamino]-N,N-dimethylbenzamide (PubChem CID 24629332) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is 3-[(2-chloro-4-methylphenyl)sulfonylamino]-N,N-dimethylbenzamide.
| Compound Name | 3-[(2-chloro-4-methylphenyl)sulfonylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 24629332 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 3-[(2-chloro-4-methylphenyl)sulfonylamino]-N,N-dimethylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(C(=O)N(C)C)c2)c(Cl)c1 |
| InChI | InChI=1S/C16H17ClN2O3S/c1-11-7-8-15(14(17)9-11)23(21,22)18-13-6-4-5-12(10-13)16(20)19(2)3/h4-10,18H,1-3H3 |
| InChIKey | ATDMQFXQDJQOEO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |