C18H22N2O3S — CID 171822680
N,N-dimethyl-3-[(2,4,5-trimethylphenyl)sulfonylamino]benzamide (PubChem CID 171822680) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N,N-dimethyl-3-[(2,4,5-trimethylphenyl)sulfonylamino]benzamide.
| Compound Name | N,N-dimethyl-3-[(2,4,5-trimethylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 171822680 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N,N-dimethyl-3-[(2,4,5-trimethylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2cccc(C(=O)N(C)C)c2)cc1C |
| InChI | InChI=1S/C18H22N2O3S/c1-12-9-14(3)17(10-13(12)2)24(22,23)19-16-8-6-7-15(11-16)18(21)20(4)5/h6-11,19H,1-5H3 |
| InChIKey | GGERPAMMUWHHAT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |