C15H15N3O5S — CID 24629243
N,N-dimethyl-3-[(4-nitrophenyl)sulfonylamino]benzamide (PubChem CID 24629243) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is N,N-dimethyl-3-[(4-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N,N-dimethyl-3-[(4-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 24629243 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N,N-dimethyl-3-[(4-nitrophenyl)sulfonylamino]benzamide |
| SMILES | CN(C)C(=O)c1cccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C15H15N3O5S/c1-17(2)15(19)11-4-3-5-12(10-11)16-24(22,23)14-8-6-13(7-9-14)18(20)21/h3-10,16H,1-2H3 |
| InChIKey | ZXMDCKDNXWOPTM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|