C21H17F2NO4S — CID 68689417
3-[2-[3-[(2,6-difluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 68689417) has the molecular formula C21H17F2NO4S and a molecular weight of 417.43 g/mol. Its IUPAC name is 3-[2-[3-[(2,6-difluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 3-[2-[3-[(2,6-difluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68689417 |
| Molecular Formula | C21H17F2NO4S |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 3-[2-[3-[(2,6-difluorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CCc2cccc(NS(=O)(=O)c3c(F)cccc3F)c2)c1 |
| InChI | InChI=1S/C21H17F2NO4S/c22-18-8-3-9-19(23)20(18)29(27,28)24-17-7-2-5-15(13-17)11-10-14-4-1-6-16(12-14)21(25)26/h1-9,12-13,24H,10-11H2,(H,25,26) |
| InChIKey | IXQMSXLYLFLBCB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |