C16H16FNO4S — CID 166224473
3-[2-[(2-fluorophenyl)methylsulfonylamino]ethyl]benzoic acid (PubChem CID 166224473) has the molecular formula C16H16FNO4S and a molecular weight of 337.37 g/mol. Its IUPAC name is 3-[2-[(2-fluorophenyl)methylsulfonylamino]ethyl]benzoic acid.
| Compound Name | 3-[2-[(2-fluorophenyl)methylsulfonylamino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 166224473 |
| Molecular Formula | C16H16FNO4S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-[2-[(2-fluorophenyl)methylsulfonylamino]ethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CCNS(=O)(=O)Cc2ccccc2F)c1 |
| InChI | InChI=1S/C16H16FNO4S/c17-15-7-2-1-5-14(15)11-23(21,22)18-9-8-12-4-3-6-13(10-12)16(19)20/h1-7,10,18H,8-9,11H2,(H,19,20) |
| InChIKey | VHCJHWJJHLDWOA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |