C11H11F2NO3 — CID 103513300
3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid (PubChem CID 103513300) has the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. Its IUPAC name is 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid.
| Compound Name | 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 103513300 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CCNC(=O)C(F)F)c1 |
| InChI | InChI=1S/C11H11F2NO3/c12-9(13)10(15)14-5-4-7-2-1-3-8(6-7)11(16)17/h1-3,6,9H,4-5H2,(H,14,15)(H,16,17) |
| InChIKey | ZHJPCUJMZCBVRZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |