3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid

C11H11F2NO3 — CID 103513300

IUPAC3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid
SMILESO=C(O)c1cccc(CCNC(=O)C(F)F)c1
InChIInChI=1S/C11H11F2NO3/c12-9(13)10(15)14-5-4-7-2-1-3-8(6-7)11(16)17/h1-3,6,9H,4-5H2,(H,14,15)(H,16,17)
InChIKeyZHJPCUJMZCBVRZ-UHFFFAOYSA-N
MW243.21 g/mol
LogP1.31
Rot. Bonds5

About 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid

3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid (PubChem CID 103513300) has the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. Its IUPAC name is 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid.

Molecular Properties

Compound Name3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid
PubChem CID103513300
Molecular FormulaC11H11F2NO3
Molecular Weight243.21 g/mol
Exact Mass243.07
IUPAC Name3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid
SMILESO=C(O)c1cccc(CCNC(=O)C(F)F)c1
InChIInChI=1S/C11H11F2NO3/c12-9(13)10(15)14-5-4-7-2-1-3-8(6-7)11(16)17/h1-3,6,9H,4-5H2,(H,14,15)(H,16,17)
InChIKeyZHJPCUJMZCBVRZ-UHFFFAOYSA-N
XLogP1.31
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.21
LogP ≤ 51.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid?
The IUPAC name of 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid (CID 103513300) is 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid.
What is the SMILES notation for 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid?
The canonical SMILES for 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid is O=C(O)c1cccc(CCNC(=O)C(F)F)c1.
What is the InChIKey of 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid?
The InChIKey is ZHJPCUJMZCBVRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO3/c12-9(13)10(15)14-5-4-7-2-1-3-8(6-7)11(16)17/h1-3,6,9H,4-5H2,(H,14,15)(H,16,17).
What are the key properties of 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid?
3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid has a molecular weight of 243.21 g/mol, XLogP of 1.31, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid is sourced from PubChem (CID 103513300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).