3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid

C13H17NO4 — CID 63795816

IUPAC3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid
SMILESCCOCC(=O)NCCc1cccc(C(=O)O)c1
InChIInChI=1S/C13H17NO4/c1-2-18-9-12(15)14-7-6-10-4-3-5-11(8-10)13(16)17/h3-5,8H,2,6-7,9H2,1H3,(H,14,15)(H,16,17)
InChIKeyGMCSLRGBAGCQHH-UHFFFAOYSA-N
MW251.28 g/mol
LogP1.08
Rot. Bonds7

About 3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid

3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid (PubChem CID 63795816) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid.

Molecular Properties

Compound Name3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid
PubChem CID63795816
Molecular FormulaC13H17NO4
Molecular Weight251.28 g/mol
Exact Mass251.12
IUPAC Name3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid
SMILESCCOCC(=O)NCCc1cccc(C(=O)O)c1
InChIInChI=1S/C13H17NO4/c1-2-18-9-12(15)14-7-6-10-4-3-5-11(8-10)13(16)17/h3-5,8H,2,6-7,9H2,1H3,(H,14,15)(H,16,17)
InChIKeyGMCSLRGBAGCQHH-UHFFFAOYSA-N
XLogP1.08
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.28
LogP ≤ 51.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-[2-[(2-methoxyacetyl)amino]ethyl]benzoic acid
CID 63795093
3-[2-(ethoxycarbonylamino)ethyl]benzoic acid
CID 63794940
3-[2-[[2-[(4-ethoxybenzoyl)amino]acetyl]amino]ethyl]benzoic acid
CID 120535479
3-(2-benzamidoethyl)benzoic acid;ethane
CID 91475554
3-[2-[(2,2-difluoroacetyl)amino]ethyl]benzoic acid
CID 103513300
3-[2-(propan-2-yloxycarbonylamino)ethyl]benzoic acid
CID 63795289
3-[2-(pentylcarbamoylamino)ethyl]benzoic acid
CID 63794580
3-[2-[(2-amino-3-methylpentanoyl)amino]ethyl]benzoic acid
CID 63795309
3-[2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]ethyl]benzoic acid
CID 79264408
3-[2-[(3-benzamido-3-phenylpropanoyl)amino]ethyl]benzoic acid
CID 166201872
3-[2-[(2-amino-3-methylbutanoyl)amino]ethyl]benzoic acid
CID 63794615
3-[2-[di(propan-2-yl)carbamoylamino]ethyl]benzoic acid
CID 166290393

Frequently Asked Questions

What is the IUPAC name of 3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid?
The IUPAC name of 3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid (CID 63795816) is 3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid.
What is the SMILES notation for 3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid?
The canonical SMILES for 3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid is CCOCC(=O)NCCc1cccc(C(=O)O)c1.
What is the InChIKey of 3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid?
The InChIKey is GMCSLRGBAGCQHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-2-18-9-12(15)14-7-6-10-4-3-5-11(8-10)13(16)17/h3-5,8H,2,6-7,9H2,1H3,(H,14,15)(H,16,17).
What are the key properties of 3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid?
3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid has a molecular weight of 251.28 g/mol, XLogP of 1.08, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(2-ethoxyacetyl)amino]ethyl]benzoic acid is sourced from PubChem (CID 63795816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).