C25H24N2O4 — CID 166201872
3-[2-[(3-benzamido-3-phenylpropanoyl)amino]ethyl]benzoic acid (PubChem CID 166201872) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-[2-[(3-benzamido-3-phenylpropanoyl)amino]ethyl]benzoic acid.
| Compound Name | 3-[2-[(3-benzamido-3-phenylpropanoyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 166201872 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 3-[2-[(3-benzamido-3-phenylpropanoyl)amino]ethyl]benzoic acid |
| SMILES | O=C(CC(NC(=O)c1ccccc1)c1ccccc1)NCCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H24N2O4/c28-23(26-15-14-18-8-7-13-21(16-18)25(30)31)17-22(19-9-3-1-4-10-19)27-24(29)20-11-5-2-6-12-20/h1-13,16,22H,14-15,17H2,(H,26,28)(H,27,29)(H,30,31) |
| InChIKey | SEESQXCSZAGYBL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |