C23H25F3N2O6S2 — CID 166422660
3-[2-[(3-benzamido-3-phenylpropanoyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166422660) has the molecular formula C23H25F3N2O6S2 and a molecular weight of 546.59 g/mol. Its IUPAC name is 3-[2-[(3-benzamido-3-phenylpropanoyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[(3-benzamido-3-phenylpropanoyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166422660 |
| Molecular Formula | C23H25F3N2O6S2 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | 3-[2-[(3-benzamido-3-phenylpropanoyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCSSCCNC(=O)CC(NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O4S2.C2HF3O2/c24-19(22-12-14-29-28-13-11-20(25)26)15-18(16-7-3-1-4-8-16)23-21(27)17-9-5-2-6-10-17;3-2(4,5)1(6)7/h1-10,18H,11-15H2,(H,22,24)(H,23,27)(H,25,26);(H,6,7) |
| InChIKey | JTMPIJDERWTNKM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|