C13H12F2N2O4S2 — CID 35540385
2,6-difluoro-N-[3-(methanesulfonamido)phenyl]benzenesulfonamide (PubChem CID 35540385) has the molecular formula C13H12F2N2O4S2 and a molecular weight of 362.38 g/mol. Its IUPAC name is 2,6-difluoro-N-[3-(methanesulfonamido)phenyl]benzenesulfonamide.
| Compound Name | 2,6-difluoro-N-[3-(methanesulfonamido)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 35540385 |
| Molecular Formula | C13H12F2N2O4S2 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2,6-difluoro-N-[3-(methanesulfonamido)phenyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(NS(=O)(=O)c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C13H12F2N2O4S2/c1-22(18,19)16-9-4-2-5-10(8-9)17-23(20,21)13-11(14)6-3-7-12(13)15/h2-8,16-17H,1H3 |
| InChIKey | OHMGNSALAGDDPC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |