C13H10ClF2NO2S — CID 3844257
N-(3-chloro-4-methylphenyl)-2,6-difluorobenzenesulfonamide (PubChem CID 3844257) has the molecular formula C13H10ClF2NO2S and a molecular weight of 317.74 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2,6-difluorobenzenesulfonamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3844257 |
| Molecular Formula | C13H10ClF2NO2S |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2,6-difluorobenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2c(F)cccc2F)cc1Cl |
| InChI | InChI=1S/C13H10ClF2NO2S/c1-8-5-6-9(7-10(8)14)17-20(18,19)13-11(15)3-2-4-12(13)16/h2-7,17H,1H3 |
| InChIKey | YJAIDVURWAZKBS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |