C13H8F5NO2S — CID 20703904
2,3,4,5,6-pentafluoro-N-(3-methylphenyl)benzenesulfonamide (PubChem CID 20703904) has the molecular formula C13H8F5NO2S and a molecular weight of 337.27 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(3-methylphenyl)benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(3-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 20703904 |
| Molecular Formula | C13H8F5NO2S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(3-methylphenyl)benzenesulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C13H8F5NO2S/c1-6-3-2-4-7(5-6)19-22(20,21)13-11(17)9(15)8(14)10(16)12(13)18/h2-5,19H,1H3 |
| InChIKey | RETZIYCLUCGFNP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|