C16H19NO5S — CID 110759298
2,4,6-trimethoxy-N-(3-methylphenyl)benzenesulfonamide (PubChem CID 110759298) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2,4,6-trimethoxy-N-(3-methylphenyl)benzenesulfonamide.
| Compound Name | 2,4,6-trimethoxy-N-(3-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110759298 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2,4,6-trimethoxy-N-(3-methylphenyl)benzenesulfonamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)Nc2cccc(C)c2)c(OC)c1 |
| InChI | InChI=1S/C16H19NO5S/c1-11-6-5-7-12(8-11)17-23(18,19)16-14(21-3)9-13(20-2)10-15(16)22-4/h5-10,17H,1-4H3 |
| InChIKey | ZVGYAVFQRFHPCO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |