C9H14N2O5S — CID 96666055
2,4,6-trimethoxybenzenesulfonohydrazide (PubChem CID 96666055) has the molecular formula C9H14N2O5S and a molecular weight of 262.29 g/mol. Its IUPAC name is 2,4,6-trimethoxybenzenesulfonohydrazide.
| Compound Name | 2,4,6-trimethoxybenzenesulfonohydrazide |
|---|---|
| PubChem CID | 96666055 |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2,4,6-trimethoxybenzenesulfonohydrazide |
| SMILES | COc1cc(OC)c(S(=O)(=O)NN)c(OC)c1 |
| InChI | InChI=1S/C9H14N2O5S/c1-14-6-4-7(15-2)9(8(5-6)16-3)17(12,13)11-10/h4-5,11H,10H2,1-3H3 |
| InChIKey | XOUOHELTWKFVEA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|