C10H17N3O3 — CID 116947477
hydrazinyl-(2,4,6-trimethoxyphenyl)methanamine (PubChem CID 116947477) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is hydrazinyl-(2,4,6-trimethoxyphenyl)methanamine.
| Compound Name | hydrazinyl-(2,4,6-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 116947477 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | hydrazinyl-(2,4,6-trimethoxyphenyl)methanamine |
| SMILES | COc1cc(OC)c(C(N)NN)c(OC)c1 |
| InChI | InChI=1S/C10H17N3O3/c1-14-6-4-7(15-2)9(10(11)13-12)8(5-6)16-3/h4-5,10,13H,11-12H2,1-3H3 |
| InChIKey | KUHZCQHZVZVJEU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|