C11H14N2O3 — CID 43344273
2-amino-2-(2,4,6-trimethoxyphenyl)acetonitrile (PubChem CID 43344273) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-amino-2-(2,4,6-trimethoxyphenyl)acetonitrile.
| Compound Name | 2-amino-2-(2,4,6-trimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 43344273 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-amino-2-(2,4,6-trimethoxyphenyl)acetonitrile |
| SMILES | COc1cc(OC)c(C(N)C#N)c(OC)c1 |
| InChI | InChI=1S/C11H14N2O3/c1-14-7-4-9(15-2)11(8(13)6-12)10(5-7)16-3/h4-5,8H,13H2,1-3H3 |
| InChIKey | CQDQKFFDMVLFPF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |