C12H16N2O — CID 116851070
2-amino-2-(4-methoxy-2,3,6-trimethylphenyl)acetonitrile (PubChem CID 116851070) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-amino-2-(4-methoxy-2,3,6-trimethylphenyl)acetonitrile.
| Compound Name | 2-amino-2-(4-methoxy-2,3,6-trimethylphenyl)acetonitrile |
|---|---|
| PubChem CID | 116851070 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-amino-2-(4-methoxy-2,3,6-trimethylphenyl)acetonitrile |
| SMILES | COc1cc(C)c(C(N)C#N)c(C)c1C |
| InChI | InChI=1S/C12H16N2O/c1-7-5-11(15-4)8(2)9(3)12(7)10(14)6-13/h5,10H,14H2,1-4H3 |
| InChIKey | HPHTUXAZDSINGE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |