C12H17NO2 — CID 116939106
2-amino-2-(4-methoxy-2,3,6-trimethylphenyl)acetaldehyde (PubChem CID 116939106) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-amino-2-(4-methoxy-2,3,6-trimethylphenyl)acetaldehyde.
| Compound Name | 2-amino-2-(4-methoxy-2,3,6-trimethylphenyl)acetaldehyde |
|---|---|
| PubChem CID | 116939106 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-amino-2-(4-methoxy-2,3,6-trimethylphenyl)acetaldehyde |
| SMILES | COc1cc(C)c(C(N)C=O)c(C)c1C |
| InChI | InChI=1S/C12H17NO2/c1-7-5-11(15-4)8(2)9(3)12(7)10(13)6-14/h5-6,10H,13H2,1-4H3 |
| InChIKey | VVCLDMXIUCWKQV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|