C12H17BrO2 — CID 174571134
4-(1-bromoethyl)-1,2-dimethoxy-3,5-dimethylbenzene (PubChem CID 174571134) has the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. Its IUPAC name is 4-(1-bromoethyl)-1,2-dimethoxy-3,5-dimethylbenzene.
| Compound Name | 4-(1-bromoethyl)-1,2-dimethoxy-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 174571134 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 4-(1-bromoethyl)-1,2-dimethoxy-3,5-dimethylbenzene |
| SMILES | COc1cc(C)c(C(C)Br)c(C)c1OC |
| InChI | InChI=1S/C12H17BrO2/c1-7-6-10(14-4)12(15-5)8(2)11(7)9(3)13/h6,9H,1-5H3 |
| InChIKey | JMSSDRRHPMQJMD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|