C10H13IO2 — CID 3257155
1-iodo-4,5-dimethoxy-2,3-dimethylbenzene (PubChem CID 3257155) has the molecular formula C10H13IO2 and a molecular weight of 292.12 g/mol. Its IUPAC name is 1-iodo-4,5-dimethoxy-2,3-dimethylbenzene.
| Compound Name | 1-iodo-4,5-dimethoxy-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 3257155 |
| Molecular Formula | C10H13IO2 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 1-iodo-4,5-dimethoxy-2,3-dimethylbenzene |
| SMILES | COc1cc(I)c(C)c(C)c1OC |
| InChI | InChI=1S/C10H13IO2/c1-6-7(2)10(13-4)9(12-3)5-8(6)11/h5H,1-4H3 |
| InChIKey | ITOMHCJOKAMGHW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|