C16H17IO3 — CID 11143485
1-iodo-4,5-dimethoxy-3-methyl-2-phenylmethoxybenzene (PubChem CID 11143485) has the molecular formula C16H17IO3 and a molecular weight of 384.21 g/mol. Its IUPAC name is 1-iodo-4,5-dimethoxy-3-methyl-2-phenylmethoxybenzene.
| Compound Name | 1-iodo-4,5-dimethoxy-3-methyl-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 11143485 |
| Molecular Formula | C16H17IO3 |
| Molecular Weight | 384.21 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 1-iodo-4,5-dimethoxy-3-methyl-2-phenylmethoxybenzene |
| SMILES | COc1cc(I)c(OCc2ccccc2)c(C)c1OC |
| InChI | InChI=1S/C16H17IO3/c1-11-15(20-10-12-7-5-4-6-8-12)13(17)9-14(18-2)16(11)19-3/h4-9H,10H2,1-3H3 |
| InChIKey | SOVHNUVKNPPKGR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|