C7H4I4O — CID 163208160
1,2,3,4-tetraiodo-5-methoxybenzene (PubChem CID 163208160) has the molecular formula C7H4I4O and a molecular weight of 611.72 g/mol. Its IUPAC name is 1,2,3,4-tetraiodo-5-methoxybenzene.
| Compound Name | 1,2,3,4-tetraiodo-5-methoxybenzene |
|---|---|
| PubChem CID | 163208160 |
| Molecular Formula | C7H4I4O |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.64 |
| IUPAC Name | 1,2,3,4-tetraiodo-5-methoxybenzene |
| SMILES | COc1cc(I)c(I)c(I)c1I |
| InChI | InChI=1S/C7H4I4O/c1-12-4-2-3(8)5(9)7(11)6(4)10/h2H,1H3 |
| InChIKey | OURVRJQWQADMLO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|