C12H17IO2 — CID 18788666
1-tert-butyl-4-iodo-2,5-dimethoxybenzene (PubChem CID 18788666) has the molecular formula C12H17IO2 and a molecular weight of 320.17 g/mol. Its IUPAC name is 1-tert-butyl-4-iodo-2,5-dimethoxybenzene.
| Compound Name | 1-tert-butyl-4-iodo-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 18788666 |
| Molecular Formula | C12H17IO2 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 1-tert-butyl-4-iodo-2,5-dimethoxybenzene |
| SMILES | COc1cc(C(C)(C)C)c(OC)cc1I |
| InChI | InChI=1S/C12H17IO2/c1-12(2,3)8-6-11(15-5)9(13)7-10(8)14-4/h6-7H,1-5H3 |
| InChIKey | NEHMRXFLXJZUNB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|