C12H17FO2 — CID 148903890
1-tert-butyl-5-fluoro-2,4-dimethoxybenzene (PubChem CID 148903890) has the molecular formula C12H17FO2 and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-tert-butyl-5-fluoro-2,4-dimethoxybenzene.
| Compound Name | 1-tert-butyl-5-fluoro-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 148903890 |
| Molecular Formula | C12H17FO2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-tert-butyl-5-fluoro-2,4-dimethoxybenzene |
| SMILES | COc1cc(OC)c(C(C)(C)C)cc1F |
| InChI | InChI=1S/C12H17FO2/c1-12(2,3)8-6-9(13)11(15-5)7-10(8)14-4/h6-7H,1-5H3 |
| InChIKey | PHHZFPQIFCTJIN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |