C9H9FO3 — CID 10035290
5-fluoro-2,4-dimethoxybenzaldehyde (PubChem CID 10035290) has the molecular formula C9H9FO3 and a molecular weight of 184.17 g/mol. Its IUPAC name is 5-fluoro-2,4-dimethoxybenzaldehyde.
| Compound Name | 5-fluoro-2,4-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 10035290 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 5-fluoro-2,4-dimethoxybenzaldehyde |
| SMILES | COc1cc(OC)c(C=O)cc1F |
| InChI | InChI=1S/C9H9FO3/c1-12-8-4-9(13-2)7(10)3-6(8)5-11/h3-5H,1-2H3 |
| InChIKey | QPJPELUSHAZZHM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|