C11H10O3 — CID 102448041
5-ethynyl-2,4-dimethoxybenzaldehyde (PubChem CID 102448041) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is 5-ethynyl-2,4-dimethoxybenzaldehyde.
| Compound Name | 5-ethynyl-2,4-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 102448041 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 5-ethynyl-2,4-dimethoxybenzaldehyde |
| SMILES | C#Cc1cc(C=O)c(OC)cc1OC |
| InChI | InChI=1S/C11H10O3/c1-4-8-5-9(7-12)11(14-3)6-10(8)13-2/h1,5-7H,2-3H3 |
| InChIKey | VGMDCJMUDGBBGR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|