C9H11NO3 — CID 10888543
2-amino-4,5-dimethoxybenzaldehyde (PubChem CID 10888543) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-amino-4,5-dimethoxybenzaldehyde.
| Compound Name | 2-amino-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 10888543 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-amino-4,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(N)c(C=O)cc1OC |
| InChI | InChI=1S/C9H11NO3/c1-12-8-3-6(5-11)7(10)4-9(8)13-2/h3-5H,10H2,1-2H3 |
| InChIKey | FLTCPRADVSSLDM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|