C12H16O4 — CID 614240
2,5-dimethoxy-4-propoxybenzaldehyde (PubChem CID 614240) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2,5-dimethoxy-4-propoxybenzaldehyde.
| Compound Name | 2,5-dimethoxy-4-propoxybenzaldehyde |
|---|---|
| PubChem CID | 614240 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2,5-dimethoxy-4-propoxybenzaldehyde |
| SMILES | CCCOc1cc(OC)c(C=O)cc1OC |
| InChI | InChI=1S/C12H16O4/c1-4-5-16-12-7-10(14-2)9(8-13)6-11(12)15-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | QSBRHRZLPYAVNF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|