C12H13Br2IO2 — CID 58718325
1-(2,2-dibromoethenyl)-2-iodo-5-methoxy-4-propoxybenzene (PubChem CID 58718325) has the molecular formula C12H13Br2IO2 and a molecular weight of 475.95 g/mol. Its IUPAC name is 1-(2,2-dibromoethenyl)-2-iodo-5-methoxy-4-propoxybenzene.
| Compound Name | 1-(2,2-dibromoethenyl)-2-iodo-5-methoxy-4-propoxybenzene |
|---|---|
| PubChem CID | 58718325 |
| Molecular Formula | C12H13Br2IO2 |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 473.83 |
| IUPAC Name | 1-(2,2-dibromoethenyl)-2-iodo-5-methoxy-4-propoxybenzene |
| SMILES | CCCOc1cc(I)c(C=C(Br)Br)cc1OC |
| InChI | InChI=1S/C12H13Br2IO2/c1-3-4-17-11-7-9(15)8(6-12(13)14)5-10(11)16-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | CZLJFJJPKJDXQQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|