C18H18BrIO4 — CID 102181393
1-bromo-2-[(E)-2-(2-iodo-4,5-dimethoxyphenyl)ethenyl]-4,5-dimethoxybenzene (PubChem CID 102181393) has the molecular formula C18H18BrIO4 and a molecular weight of 505.15 g/mol. Its IUPAC name is 1-bromo-2-[(E)-2-(2-iodo-4,5-dimethoxyphenyl)ethenyl]-4,5-dimethoxybenzene.
| Compound Name | 1-bromo-2-[(E)-2-(2-iodo-4,5-dimethoxyphenyl)ethenyl]-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 102181393 |
| Molecular Formula | C18H18BrIO4 |
| Molecular Weight | 505.15 g/mol |
| Exact Mass | 503.94 |
| IUPAC Name | 1-bromo-2-[(E)-2-(2-iodo-4,5-dimethoxyphenyl)ethenyl]-4,5-dimethoxybenzene |
| SMILES | COc1cc(Br)c(/C=C/c2cc(OC)c(OC)cc2I)cc1OC |
| InChI | InChI=1S/C18H18BrIO4/c1-21-15-7-11(13(19)9-17(15)23-3)5-6-12-8-16(22-2)18(24-4)10-14(12)20/h5-10H,1-4H3/b6-5+ |
| InChIKey | HZKRHIKTTXVNFI-AATRIKPKSA-N |
| XLogP | 5.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.15 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|