C11H13BrN2O3 — CID 131848176
3-(2-bromo-4,5-dimethoxyphenyl)prop-2-enehydrazide (PubChem CID 131848176) has the molecular formula C11H13BrN2O3 and a molecular weight of 301.14 g/mol. Its IUPAC name is 3-(2-bromo-4,5-dimethoxyphenyl)prop-2-enehydrazide.
| Compound Name | 3-(2-bromo-4,5-dimethoxyphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 131848176 |
| Molecular Formula | C11H13BrN2O3 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 3-(2-bromo-4,5-dimethoxyphenyl)prop-2-enehydrazide |
| SMILES | COc1cc(Br)c(C=CC(=O)NN)cc1OC |
| InChI | InChI=1S/C11H13BrN2O3/c1-16-9-5-7(3-4-11(15)14-13)8(12)6-10(9)17-2/h3-6H,13H2,1-2H3,(H,14,15) |
| InChIKey | JWMHZURIVRMNNF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|